CAS 99585-94-1
:2-chloro-N-(3-chloro-2-methylphenyl)acetamide
Description:
2-Chloro-N-(3-chloro-2-methylphenyl)acetamide, with the CAS number 99585-94-1, is an organic compound characterized by its acetamide functional group and the presence of chlorine substituents on the aromatic ring. This compound typically appears as a solid or crystalline substance and is soluble in organic solvents. Its molecular structure includes a chloro group at the 2-position of the acetamide and a 3-chloro-2-methylphenyl group, which contributes to its chemical reactivity and potential biological activity. The presence of chlorine atoms can enhance the compound's lipophilicity, affecting its interaction with biological systems. This compound may be of interest in pharmaceutical research and development due to its potential applications in medicinal chemistry. Safety data should be consulted for handling and exposure risks, as halogenated compounds can exhibit varying degrees of toxicity and environmental impact. Overall, 2-chloro-N-(3-chloro-2-methylphenyl)acetamide represents a specific class of chlorinated organic compounds with unique properties and potential applications.
Formula:C9H9Cl2NO
InChI:InChI=1/C9H9Cl2NO/c1-6-7(11)3-2-4-8(6)12-9(13)5-10/h2-4H,5H2,1H3,(H,12,13)
SMILES:Cc1c(cccc1N=C(CCl)O)Cl
Synonyms:- Acetamide, 2-chloro-N-(3-chloro-2-methylphenyl)-
- 2-Chloro-N-(3-chloro-2-methylphenyl)acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
