CymitQuimica logo

CAS 99585-98-5

:

3-chloro-N-(3-chlorophenyl)propanamide

Description:
3-Chloro-N-(3-chlorophenyl)propanamide is an organic compound characterized by its amide functional group, which is derived from propanoic acid. The presence of two chlorine atoms on the aromatic ring and the propanamide structure contributes to its unique chemical properties. This compound typically appears as a solid at room temperature and is likely to be soluble in organic solvents due to its hydrophobic characteristics, while its amide group may impart some degree of polarity. The chlorinated phenyl group can influence its reactivity, making it potentially useful in various chemical reactions, including nucleophilic substitutions. Additionally, the compound may exhibit biological activity, which could be of interest in pharmaceutical research. Its molecular structure suggests that it may participate in hydrogen bonding, affecting its melting and boiling points. Safety data should be consulted for handling, as chlorinated compounds can pose environmental and health risks. Overall, 3-chloro-N-(3-chlorophenyl)propanamide is a compound of interest in both synthetic organic chemistry and potential medicinal applications.
Formula:C9H9Cl2NO
InChI:InChI=1/C9H9Cl2NO/c10-5-4-9(13)12-8-3-1-2-7(11)6-8/h1-3,6H,4-5H2,(H,12,13)
InChI key:PPDCJGYLZPSGAW-UHFFFAOYSA-N
SMILES:c1cc(cc(c1)N=C(CCCl)O)Cl
Synonyms:
  • propanamide, 3-chloro-N-(3-chlorophenyl)-
Found 3 products.