CAS 99586-30-8

(2-bromophenyl)-(3-chlorophenyl)methanone

Description:

(2-bromophenyl)-(3-chlorophenyl)methanone, with the CAS number 99586-30-8, is an organic compound characterized by the presence of a ketone functional group attached to a biphenyl structure. This compound features a bromine atom at the second position of one phenyl ring and a chlorine atom at the third position of the other phenyl ring, contributing to its unique reactivity and physical properties. Typically, such compounds exhibit moderate to high lipophilicity due to the aromatic rings, which can influence their solubility in organic solvents. The presence of halogen substituents can also enhance the compound's electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its stability and reactivity can be influenced by the electronic effects of the bromine and chlorine substituents, which can affect the compound's overall behavior in chemical processes. Safety data should be consulted for handling and usage, as halogenated compounds can pose environmental and health risks.

Formula: C₁₃H₈BrClO

InChI: InChI=1/C13H8BrClO/c14-12-7-2-1-6-11(12)13(16)9-4-3-5-10(15)8-9/h1-8H

SMILES: c1ccc(c(c1)C(=O)c1cccc(c1)Cl)Br

Synonyms:

• 2-BROMO-3'-CHLOROBENZOPHENONE
• Methanone, (2-bromophenyl)(3-chlorophenyl)-
• (2-Bromo-phenyl)-(3-chloro-phenyl)-methanone