CAS 99595-85-4

3-methoxy-2-nitrobenzamide

Description:

3-Methoxy-2-nitrobenzamide is an organic compound characterized by its aromatic structure, which includes a methoxy group (-OCH3) and a nitro group (-NO2) attached to a benzamide framework. The presence of these functional groups imparts specific chemical properties, such as increased polarity and potential reactivity. The methoxy group typically enhances solubility in organic solvents, while the nitro group can influence the compound's electron-withdrawing characteristics, affecting its reactivity in electrophilic substitution reactions. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure allows for various interactions, including hydrogen bonding due to the amide functional group. Additionally, 3-methoxy-2-nitrobenzamide can be synthesized through specific chemical reactions involving nitro and methoxy substitutions on the benzene ring. Safety data should be consulted for handling, as nitro compounds can be sensitive and potentially hazardous. Overall, this compound serves as a valuable building block in organic synthesis and medicinal chemistry.

Formula: C₈H₈N₂O₄

InChI: InChI=1/C8H8N2O4/c1-14-6-4-2-3-5(8(9)11)7(6)10(12)13/h2-4H,1H3,(H2,9,11)

SMILES: COc1cccc(c1N(=O)=O)C(=N)O

3-Methoxy-2-nitrobenzamide

CAS: 99595-85-4

Formula: C₈H₈N₂O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 196.1601

Ref: IN-DA005SA6

3-Methoxy-2-nitrobenzamide

CAS: 99595-85-4

3-Methoxy-2-nitrobenzamide

Purity: 98%

Molecular weight: 196.16g/mol

Ref: 54-OR1005169

3-Methoxy-2-nitrobenzamide

CAS: 99595-85-4

Purity: 98%

Molecular weight: 196.162

Ref: 10-F988563

3-METHOXY-2-NITROBENZAMIDE

CAS: 99595-85-4

Purity: 98%

Molecular weight: 196.1620026

Ref: 10-F850230