CAS 996-97-4
:N,N-Diethyloctanamide
Description:
N,N-Diethyloctanamide is an organic compound characterized by its amide functional group, where the nitrogen atom is bonded to two ethyl groups and a long-chain octyl group. This structure contributes to its hydrophobic nature, making it less soluble in water but more soluble in organic solvents. The compound typically appears as a colorless to pale yellow liquid with a characteristic odor. It has a relatively high boiling point due to the presence of the long hydrocarbon chain, which also influences its physical properties, such as viscosity and density. N,N-Diethyloctanamide is used in various applications, including as a solvent, surfactant, or in the formulation of lubricants and plasticizers. Its chemical stability and low volatility make it suitable for use in industrial processes. However, like many amides, it may undergo hydrolysis under certain conditions, leading to the formation of the corresponding carboxylic acid and amine. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C12H25NO
InChI:InChI=1S/C12H25NO/c1-4-7-8-9-10-11-12(14)13(5-2)6-3/h4-11H2,1-3H3
InChI key:InChIKey=FHJRFIYKPIXQNQ-UHFFFAOYSA-N
SMILES:N(C(CCCCCCC)=O)(CC)CC
Synonyms:- Ai3-31056
- Caprylic acid diethylamide
- N,N-Diethyloctamide
- N,N-Diethyloctylamide
- Nsc 3916
- Octanamide, N,N-diethyl-
- Repellent 790
- N,N-Diethyloctanamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
