CAS 99623-12-8

N'-hydroxycyclopentanecarboximidamide

Description:

N'-hydroxycyclopentanecarboximidamide is a chemical compound characterized by its unique structure, which includes a cyclopentane ring, a carboximidamide functional group, and a hydroxyl group. This compound typically exhibits properties associated with both amides and hydroxyl groups, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding. The presence of the hydroxyl group may enhance its reactivity, making it a candidate for various chemical reactions, including those involving nucleophilic attack or coordination with metal ions. Additionally, the cyclic structure of the cyclopentane ring can impart specific steric and electronic properties that influence its behavior in chemical reactions. While specific physical properties such as melting point, boiling point, and solubility may vary, compounds of this nature often find applications in organic synthesis, medicinal chemistry, and materials science due to their functional versatility. As with any chemical substance, safety and handling precautions should be observed, particularly in laboratory settings.

Formula: C₆H₁₂N₂O

InChI: InChI=1/C6H12N2O/c7-6(8-9)5-3-1-2-4-5/h5,9H,1-4H2,(H2,7,8)

SMILES: C1CCC(C1)C(=N)NO

N-Hydroxy-cyclopentanecarboxamidine

CAS: 99623-12-8

N-Hydroxy-cyclopentanecarboxamidine

Purity: 95%

Molecular weight: 128.174g/mol

Ref: 54-OR97353

N'-Hydroxycyclopentanecarboximidamide

CAS: 99623-12-8

Purity: 95.0%

Molecular weight: 128.175

Ref: 10-F091336