
CAS 99624-00-7
:Benzenamine, 2-fluoro-, homopolymer
Description:
Benzenamine, 2-fluoro-, homopolymer, also known as poly(2-fluoroaniline), is a synthetic polymer derived from the polymerization of 2-fluoroaniline monomers. This substance exhibits characteristics typical of conducting polymers, including electrical conductivity, thermal stability, and the ability to undergo doping processes. The presence of the fluorine atom in the aromatic ring can influence the polymer's solubility, reactivity, and overall electronic properties, potentially enhancing its performance in various applications. The polymer is generally insoluble in common organic solvents but may be processed in specific conditions. Its unique properties make it suitable for applications in electronics, sensors, and as a component in advanced materials. Additionally, the polymer's structure allows for potential modifications, which can tailor its properties for specific uses. Safety and handling precautions should be observed, as with many synthetic polymers, due to potential toxicity and environmental concerns associated with its production and degradation.
Formula:(C6H6FN)x
InChI:InChI=1S/C6H6FN/c7-5-3-1-2-4-6(5)8/h1-4H,8H2
InChI key:InChIKey=FTZQXOJYPFINKJ-UHFFFAOYSA-N
SMILES:FC1=C(N)C=CC=C1
Synonyms:- Benzenamine, 2-fluoro-, homopolymer
- Poly(2-fluoroaniline)
- 2-Fluoroaniline homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
