CAS 99662-11-0
:1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-nitro-1H-pyrazol-5-amine
Description:
1-[2,6-Dichloro-4-(trifluoromethyl)phenyl]-4-nitro-1H-pyrazol-5-amine is a chemical compound characterized by its complex structure, which includes a pyrazole ring substituted with both a nitro group and an amine group, as well as a phenyl ring that carries dichloro and trifluoromethyl substituents. This compound is typically recognized for its potential applications in pharmaceuticals and agrochemicals, often exhibiting biological activity due to its unique functional groups. The presence of the nitro group can influence its reactivity and solubility, while the trifluoromethyl group is known to enhance lipophilicity and metabolic stability. The dichloro substituents may also contribute to its overall chemical properties, including its electronic characteristics and interaction with biological targets. As with many halogenated compounds, considerations regarding environmental impact and toxicity are essential. Overall, this compound's distinctive features make it a subject of interest in various fields, including medicinal chemistry and material science.
Formula:C10H5Cl2F3N4O2
InChI:InChI=1/C10H5Cl2F3N4O2/c11-5-1-4(10(13,14)15)2-6(12)8(5)18-9(16)7(3-17-18)19(20)21/h1-3H,16H2
SMILES:c1c(cc(c(c1Cl)n1c(c(cn1)N(=O)=O)N)Cl)C(F)(F)F
Synonyms:- 1-(2,6-Dichloro-a,a,a-trifluoro-p-tolyl)-4-nitropyrazol-5-ylamine
- 1-[2,6-Dichlor-4-(trifluormethyl)phenyl]-4-nitro-1H-pyrazol-5-amin
- 1H-pyrazol-5-amine, 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-nitro-
- 99662-11-0
- 1-[2,6-Dichloro-4-(trifluorométhyl)phényl]-4-nitro-1H-pyrazol-5-amine
- 1-[2,6-Dichloro-4-(trifluoromethyl)phenyl]-4-nitro-1H-pyrazol-5-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.