CAS 99686-52-9
:2,2'-dichloro-4,4'-bis(trifluoromethyl)biphenyl
Description:
2,2'-Dichloro-4,4'-bis(trifluoromethyl)biphenyl, with the CAS number 99686-52-9, is a synthetic organic compound belonging to the biphenyl family. This substance features two chlorine atoms and two trifluoromethyl groups attached to the biphenyl structure, which significantly influences its chemical properties. It is typically characterized by its high thermal stability and resistance to degradation, making it suitable for various industrial applications. The presence of trifluoromethyl groups enhances its lipophilicity and can affect its reactivity and solubility in organic solvents. Additionally, this compound may exhibit low volatility and a relatively high melting point, contributing to its stability under various conditions. Due to its chlorinated and fluorinated nature, it may also raise environmental and health concerns, necessitating careful handling and disposal. Overall, 2,2'-dichloro-4,4'-bis(trifluoromethyl)biphenyl is notable for its unique structural features and potential applications in materials science and chemical synthesis.
Formula:C14H6Cl2F6
InChI:InChI=1/C14H6Cl2F6/c15-11-5-7(13(17,18)19)1-3-9(11)10-4-2-8(6-12(10)16)14(20,21)22/h1-6H
SMILES:c1cc(c2ccc(cc2Cl)C(F)(F)F)c(cc1C(F)(F)F)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.