CAS 997-43-3
:Pentanedioic acid, 2-oxo-, potassium salt (1:1)
Description:
Pentanedioic acid, 2-oxo-, potassium salt (1:1), commonly known as potassium 2-oxopentanedioate, is a chemical compound characterized by its salt formation from pentanedioic acid (also known as glutaric acid) and potassium. This compound typically appears as a white to off-white crystalline solid and is soluble in water, which is a common trait for many salts. It features a dicarboxylic acid structure, with two carboxyl groups (-COOH) and a ketone group (C=O) at the second carbon position, contributing to its reactivity and potential applications in various chemical processes. The presence of potassium ions enhances its solubility and stability in aqueous solutions. This compound is often utilized in biochemical applications, including as a buffering agent or in metabolic studies, due to its role in various biochemical pathways. Additionally, it may serve as a precursor in organic synthesis and has potential uses in pharmaceuticals and agrochemicals. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C5H6O5·K
InChI:InChI=1S/C5H6O5.K/c6-3(5(9)10)1-2-4(7)8;/h1-2H2,(H,7,8)(H,9,10);
InChI key:InChIKey=KMXFRXLEEMEGTM-UHFFFAOYSA-N
SMILES:C(CCC(O)=O)(C(O)=O)=O.[K]
Synonyms:- 2-Ketoglutaric Acid Monopotassium Salt
- 2-Ketoglutaric Acid Potassium Salt
- 2-Oxoglutaric Acid Monopotassium Salt
- 2-Oxopentanedioic Acid Monopotassium Salt
- 2-Oxopentanedioic acid potassium salt
- Alpha-Ketoglutaric Acid Monopotassium Salt
- Alpha-Ketoglutaric Acid Potassium Salt
- Glutaric acid, 2-oxo-, potassium salt
- Pentanedioic Acid, 2-Oxo-, Monopotassium Salt
- Pentanedioic acid, 2-oxo-, potassium salt (1:1)
- Potassium Hydrogen 2-Oxoglutarate
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-Oxopentanedioic acid potassium salt
CAS:2-Oxopentanedioic acid potassium saltPurity:97%Molecular weight:184.19g/mol2-Ketoglutaric acid monopotassium salt
CAS:Formula:C5H5O5KPurity:≥ 99.0%Color and Shape:White to almost white powderMolecular weight:184.192-Ketoglutaric acid potassium
CAS:2-Ketoglutaric acid potassium (Alpha-Ketoglutaric acid potassium) is an intermediate in the Krebs cycle where ATP or GTP is produced. It also serves as the primary carbon backbone in nitrogen assimilation reactions. Additionally, 2-Ketoglutaric acid potassium acts as a reversible inhibitor of tyrosinase with an IC50 value of 15 mM.Formula:C5H5KO5Color and Shape:SolidMolecular weight:184.19α-Ketoglutaric acid potassium
CAS:Intermediate in the Krebs cycle; nitrogen transporter
Formula:C5H5O5KPurity:Min. 98 Area-%Color and Shape:PowderMolecular weight:184.19 g/mol





