CAS 99708-50-6

3-Chloro-6-(1-naphthalenyl)pyridazine

Description:

3-Chloro-6-(1-naphthalenyl)pyridazine is an organic compound characterized by its pyridazine core, which is a six-membered aromatic ring containing two nitrogen atoms. The presence of a chlorine atom at the 3-position and a naphthalenyl group at the 6-position contributes to its unique chemical properties. This compound typically exhibits moderate to high lipophilicity due to the naphthalene moiety, which can influence its solubility in organic solvents. It may also display interesting biological activities, making it a subject of interest in medicinal chemistry and drug development. The chlorine substituent can enhance reactivity and influence the compound's electronic properties, potentially affecting its interactions with biological targets. Additionally, 3-Chloro-6-(1-naphthalenyl)pyridazine may participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, due to the presence of the reactive chlorine atom. Overall, this compound's structural features suggest potential applications in pharmaceuticals or agrochemicals, although specific biological or chemical data would be necessary for a comprehensive understanding of its behavior and applications.

Formula: C₁₄H₉ClN₂

InChI: InChI=1S/C14H9ClN2/c15-14-9-8-13(16-17-14)12-7-3-5-10-4-1-2-6-11(10)12/h1-9H

InChI key: InChIKey=NOZNCNVAMRHYIY-UHFFFAOYSA-N

SMILES: ClC1=CC=C(C=2C3=C(C=CC2)C=CC=C3)N=N1

Synonyms:

• 3-Chloro-6-(α-naphthyl)pyridazine
• Pyridazine, 3-chloro-6-(1-naphthalenyl)-
• 3-Chloro-6-(1-naphthalenyl)pyridazine