
CAS 99709-25-8
:Bicyclo[3.2.0]heptane-3-carboxamide
Description:
Bicyclo[3.2.0]heptane-3-carboxamide is a bicyclic organic compound characterized by its unique structure, which consists of a bicycloheptane framework with a carboxamide functional group. This compound features a seven-membered ring system that includes two fused cyclopropane rings, contributing to its rigidity and strain. The presence of the carboxamide group introduces polar characteristics, enhancing its solubility in polar solvents and influencing its reactivity. Bicyclo[3.2.0]heptane-3-carboxamide may exhibit interesting chemical properties, such as potential hydrogen bonding due to the amide group, which can affect its interactions in biological systems or synthetic applications. Its structural features may also lead to unique stereochemical properties, making it a subject of interest in organic synthesis and medicinal chemistry. The compound's CAS number, 99709-25-8, allows for easy identification in chemical databases, facilitating research and development in various fields, including pharmaceuticals and materials science. Overall, this compound's distinctive bicyclic structure and functional group make it a valuable entity for study and application in chemistry.
Formula:C8H13NO
InChI:InChI=1S/C8H13NO/c9-8(10)7-3-5-1-2-6(5)4-7/h5-7H,1-4H2,(H2,9,10)
InChI key:InChIKey=DTDLJVBXWQKGQN-UHFFFAOYSA-N
SMILES:C(N)(=O)C1CC2C(C1)CC2
Synonyms:- Bicyclo[3.2.0]heptane-3-carboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.