CymitQuimica logo

CAS 99717-56-3

:

2-Bromoallyl 2,4,6-tribromophenyl ether

Description:
2-Bromoallyl 2,4,6-tribromophenyl ether is an organic compound characterized by its complex structure, which includes a brominated allyl group and a tribromophenyl ether moiety. This compound features multiple bromine substituents, which significantly influence its chemical reactivity and physical properties. The presence of the ether functional group suggests that it may exhibit moderate polarity, affecting its solubility in various solvents. The bromine atoms contribute to the compound's potential for electrophilic substitution reactions, making it a candidate for further chemical transformations. Additionally, the compound may display interesting biological activities due to its halogenated structure, which is often associated with enhanced reactivity and potential applications in pharmaceuticals or agrochemicals. Safety considerations are important when handling this compound, as brominated compounds can pose environmental and health risks. Overall, 2-Bromoallyl 2,4,6-tribromophenyl ether is a notable example of a halogenated organic compound with diverse potential applications in chemical synthesis and research.
Formula:C9H6Br4O
InChI:InChI=1S/C9H6Br4O/c1-5(10)4-14-9-7(12)2-6(11)3-8(9)13/h2-3H,1,4H2
InChI key:InChIKey=RLPZXGWCSHFKJI-UHFFFAOYSA-N
SMILES:O(CC(Br)=C)C1=C(Br)C=C(Br)C=C1Br
Synonyms:
  • Benzene, 1,3,5-tribromo-2-[(2-bromo-2-propenyl)oxy]-
  • 2-Bromoallyl 2,4,6-tribromophenyl ether
  • 1,3,5-Tribromo-2-[(2-bromo-2-propen-1-yl)oxy]benzene
  • Benzene, 1,3,5-tribromo-2-[(2-bromo-2-propen-1-yl)oxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.