CAS 99726-76-8

8-Fluoronorfloxacin

Description:

8-Fluoronorfloxacin is a synthetic fluoroquinolone antibiotic that exhibits broad-spectrum antibacterial activity. It is primarily used to treat various bacterial infections by inhibiting bacterial DNA gyrase and topoisomerase IV, enzymes critical for DNA replication and transcription. The chemical structure of 8-Fluoronorfloxacin includes a fluorine atom at the 8-position of the naphthyridine ring, which enhances its potency and spectrum of activity against Gram-negative and some Gram-positive bacteria. This compound is typically characterized by its relatively high solubility in water and organic solvents, which facilitates its formulation in various pharmaceutical preparations. Additionally, 8-Fluoronorfloxacin may exhibit side effects common to fluoroquinolones, such as gastrointestinal disturbances and potential effects on tendons. Its pharmacokinetic properties include good oral bioavailability and a moderate half-life, allowing for convenient dosing regimens. As with other antibiotics, the emergence of resistance is a concern, necessitating careful use and adherence to prescribed guidelines.

Formula: C₁₆H₁₇F₂N₃O₃

InChI: InChI=1S/C16H17F2N3O3/c1-2-20-8-10(16(23)24)15(22)9-7-11(17)14(12(18)13(9)20)21-5-3-19-4-6-21/h7-8,19H,2-6H2,1H3,(H,23,24)

InChI key: InChIKey=YHRXPOLYCUTZAM-UHFFFAOYSA-N

SMILES: C(C)N1C=2C(C(=O)C(C(O)=O)=C1)=CC(F)=C(C2F)N3CCNCC3

Synonyms:

• 1-Ethyl-6,8-difluoro-1,4-dihydro-4-oxo-7-(1-piperazinyl)-3-quinolinecarboxylic acid
• 8-Fluoronorfloxacin
• 3-Quinolinecarboxylic acid, 1-ethyl-6,8-difluoro-1,4-dihydro-4-oxo-7-(1-piperazinyl)-