CymitQuimica logo

CAS 99733-18-3

:

1-Boc-1,7-diaminoheptane

Description:
1-Boc-1,7-diaminoheptane, with the CAS number 99733-18-3, is a chemical compound characterized by the presence of a Boc (tert-butyloxycarbonyl) protecting group attached to a heptane chain with amino groups at the first and seventh positions. This structure imparts specific properties, making it useful in organic synthesis, particularly in the field of peptide chemistry. The Boc group serves as a protective moiety for the amine functionalities, allowing for selective reactions without interfering with the amino groups. The compound is typically a solid at room temperature and is soluble in polar organic solvents. Its reactivity is influenced by the amino groups, which can participate in various chemical reactions, including acylation and coupling reactions. The presence of the heptane backbone contributes to its hydrophobic characteristics, while the amino groups enhance its potential for hydrogen bonding and interaction with other polar molecules. Overall, 1-Boc-1,7-diaminoheptane is a versatile intermediate in the synthesis of more complex organic molecules.
Formula:C12H26N2O2
InChI:InChI=1/C12H26N2O2/c1-12(2,3)16-11(15)14-10-8-6-4-5-7-9-13/h4-10,13H2,1-3H3,(H,14,15)
InChI key:DTJYPERGUPPXRU-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=NCCCCCCCN)O
Synonyms:
  • Tert-Butyl (7-Aminoheptyl)Carbamate
Found 3 products.