CymitQuimica logo

CAS 99735-43-0

:

(3R)-5-oxo-1-[(1R)-1-phenylethyl]pyrrolidine-3-carboxylate

Description:
The chemical substance known as (3R)-5-oxo-1-[(1R)-1-phenylethyl]pyrrolidine-3-carboxylate, with the CAS number 99735-43-0, is a pyrrolidine derivative characterized by its unique structural features. This compound contains a pyrrolidine ring, which is a five-membered cyclic amine, and is substituted with a phenylethyl group and a carboxylate moiety. The presence of the oxo group at the 5-position contributes to its reactivity and potential biological activity. The stereochemistry indicated by the (3R) and (1R) designations suggests specific spatial arrangements of the atoms, which can significantly influence the compound's properties and interactions. Such compounds are often of interest in medicinal chemistry due to their potential pharmacological effects. The carboxylate group may enhance solubility and reactivity, making it suitable for various applications, including drug development and synthesis. Overall, this compound exemplifies the complexity and diversity of organic molecules, particularly in the context of bioactive substances.
Formula:C13H14NO3
InChI:InChI=1/C13H15NO3/c1-9(10-5-3-2-4-6-10)14-8-11(13(16)17)7-12(14)15/h2-6,9,11H,7-8H2,1H3,(H,16,17)/p-1/t9-,11-/m1/s1
InChI key:CFGKWSDAMXTRHE-MWLCHTKSSA-N
SMILES:C[C@H](c1ccccc1)N1C[C@@H](CC1=O)C(=O)[O-]
Found 4 products.