CAS 99759-68-9
:N-{4-(hydroxymethyl)-1-[2-(thiophen-3-yl)ethyl]piperidin-4-yl}-N-phenylpropanamide
Description:
N-{4-(hydroxymethyl)-1-[2-(thiophen-3-yl)ethyl]piperidin-4-yl}-N-phenylpropanamide, with the CAS number 99759-68-9, is a synthetic organic compound characterized by its complex structure, which includes a piperidine ring, a thiophene moiety, and a phenyl group. This compound features a hydroxymethyl group that enhances its solubility and reactivity. It is typically classified as an amide due to the presence of the -CONH- functional group. The presence of the thiophene ring suggests potential applications in organic electronics or as a building block in pharmaceuticals, given thiophene's role in various biological activities. The compound's piperidine structure may contribute to its pharmacological properties, as piperidine derivatives are often explored for their effects on the central nervous system. Overall, this compound's unique combination of functional groups and structural features may lead to interesting chemical behavior and potential applications in medicinal chemistry or materials science. Further studies would be necessary to fully elucidate its properties and potential uses.
Formula:C21H28N2O2S
InChI:InChI=1/C21H28N2O2S/c1-2-20(25)23(19-6-4-3-5-7-19)21(17-24)10-13-22(14-11-21)12-8-18-9-15-26-16-18/h3-7,9,15-16,24H,2,8,10-14,17H2,1H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-(4-(HYDROXYMETHYL)-1-(2-(2-THIENYL)ETHYL)-PIPERIDIN-4-YL)-N-PHENYLPRO PANAMIDE
CAS:Formula:C21H28N2O2SMolecular weight:372.5242
