CAS 99766-25-3
:Ethanone, 2,2'-tellurobis[1-(4-methoxyphenyl)-
Description:
Ethanone, 2,2'-tellurobis[1-(4-methoxyphenyl)-, also known by its CAS number 99766-25-3, is an organotellurium compound characterized by the presence of a tellurium atom bonded to two ethanone groups, each substituted with a 4-methoxyphenyl moiety. This compound typically exhibits properties associated with organometallic compounds, including potential reactivity due to the tellurium atom, which can participate in various chemical reactions. The presence of the methoxyphenyl groups may impart certain solubility characteristics, making it more soluble in organic solvents. Additionally, the compound may exhibit interesting electronic properties due to the conjugation between the aromatic rings and the carbonyl groups. Its applications could span areas such as organic synthesis, materials science, or as a precursor in the development of tellurium-based compounds. However, specific safety and handling guidelines should be followed, as organotellurium compounds can pose health risks and environmental concerns. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C18H18O4Te
InChI:InChI=1S/C18H18O4Te/c1-21-15-7-3-13(4-8-15)17(19)11-23-12-18(20)14-5-9-16(22-2)10-6-14/h3-10H,11-12H2,1-2H3
InChI key:JEPCSESSLILWIH-UHFFFAOYSA-N
SMILES:COC1=CC=C(C=C1)C(=O)C[Te]CC(=O)C2=CC=C(C=C2)OC
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery