
CAS 99768-68-0
:5-Nitro-N-2-thiazolyl-2-furancarboxamide
Description:
5-Nitro-N-2-thiazolyl-2-furancarboxamide is a chemical compound characterized by its unique structural features, which include a nitro group, a thiazole ring, and a furan moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the nitro group may impart specific reactivity and influence its interaction with biological targets. The thiazole and furan rings contribute to its aromatic character, which can affect its stability and reactivity. Additionally, the compound may exhibit various functional properties, including antimicrobial or antifungal activity, depending on its specific interactions within biological systems. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. As with many chemical substances, safety and handling precautions are essential due to potential toxicity or reactivity, and thorough characterization through methods such as NMR, IR spectroscopy, and mass spectrometry is crucial for understanding its properties and applications.
Formula:C8H5N3O4S
InChI:InChI=1S/C8H5N3O4S/c12-7(10-8-9-3-4-16-8)5-1-2-6(15-5)11(13)14/h1-4H,(H,9,10,12)
InChI key:InChIKey=NKZNKSNTMONKKG-UHFFFAOYSA-N
SMILES:C(NC1=NC=CS1)(=O)C=2OC(N(=O)=O)=CC2
Synonyms:- 5-Nitro-N-2-thiazolyl-2-furancarboxamide
- 2-Furamide, 5-nitro-N-2-thiazolyl-
- 2-Furancarboxamide, 5-nitro-N-2-thiazolyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
