CAS 99769-19-4
:(3-Methoxycarbonylphenyl)boronic acid
Description:
(3-Methoxycarbonylphenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that has a methoxycarbonyl substituent. This compound typically exhibits properties such as being a white to off-white solid, soluble in polar organic solvents like methanol and ethanol, and less soluble in non-polar solvents. The boronic acid moiety allows for participation in various chemical reactions, particularly in Suzuki coupling reactions, making it valuable in organic synthesis and materials science. Its methoxycarbonyl group enhances its reactivity and solubility, facilitating its use in the synthesis of complex organic molecules. Additionally, this compound may exhibit moderate acidity due to the boronic acid group, which can form stable complexes with diols and other Lewis bases. Overall, (3-Methoxycarbonylphenyl)boronic acid serves as a versatile building block in the development of pharmaceuticals and agrochemicals, as well as in the study of boron chemistry.
Formula:C8H9BO4
InChI:InChI=1/C8H9BO4/c1-13-8(10)6-3-2-4-7(5-6)9(11)12/h2-5,11-12H,1H3
SMILES:COC(=O)c1cccc(c1)B(O)O
Synonyms:- 3-Methoxycarbonylphenylboronic acid
- Methyl 3-Boronobenzoat
- 3-(Methyloxycarbonyl)phenylboronic acid
- Methyl 3-boronobenzoate
- 3-(methoxycarbonyl)Benzeneboronic acid
- (3-(Methoxycarbonyl)Phenyl)Boronic Acid
- 3-(Methoxycarbonyl)phenylboronic acid
- 3-Methoxycarbonylphenylbaronic Acid
- 3-(Methoxycarbonyl)phenylboronic Acid (contains varying amounts of Anhydride)
- AKOS BRN-0125
- M-(METHOXYCARBONYL)PHENYLBORONIC ACID
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3-(Methoxycarbonyl)phenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C8H9BO4Color and Shape:White to Light yellow powder to crystalMolecular weight:179.973-(Methoxycarbonyl)phenylboronic acid
CAS:Formula:C8H9BO4Purity:95%Color and Shape:SolidMolecular weight:179.96573-(Methoxycarbonyl)benzeneboronic acid
CAS:3-(Methoxycarbonyl)benzeneboronic acidFormula:C8H9BO4Purity:98%Color and Shape: off-white powderMolecular weight:179.97g/mol3-Methoxycarbonylphenylboronic acid
CAS:Formula:C8H9BO4Purity:95%Color and Shape:SolidMolecular weight:179.973-(Methoxycarbonyl)benzeneboronic acid, 97%
CAS:<p>Reagent used for tandem-type Pd(II)-catalyzed oxidative Heck reaction and intramolecular C-H amidation sequence, copper-mediated ligandless aerobic fluoroalkylation of arylboronic acids with fluoroalkyl iodides, one-pot ipso-nitration of arylboronic acids, copper-catalyzed nitration, cyclocondensati</p>Formula:C8H9BO4Purity:97%Color and Shape:Powder, White to pale creamMolecular weight:179.97





