
CAS 99769-53-6
:N1-5-Hexen-1-yldodecanediamide
Description:
N1-5-Hexen-1-yldodecanediamide, identified by its CAS number 99769-53-6, is an organic compound characterized by its amide functional group, which is formed from the reaction of a carboxylic acid and an amine. This substance features a long hydrocarbon chain, specifically a dodecanediamide structure, indicating the presence of a twelve-carbon chain with two amine groups. The "5-Hexen-1-yl" portion suggests the presence of a hexene group, which introduces unsaturation into the molecule, potentially affecting its reactivity and physical properties. Typically, compounds like this may exhibit properties such as moderate solubility in organic solvents, potential surfactant characteristics, and varying melting and boiling points depending on the molecular structure. Additionally, due to the presence of both hydrophobic (alkyl chains) and hydrophilic (amide groups) regions, this compound may have applications in fields such as materials science, surfactant formulation, or as intermediates in organic synthesis. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C18H34N2O2
InChI:InChI=1S/C18H34N2O2/c1-2-3-4-13-16-20-18(22)15-12-10-8-6-5-7-9-11-14-17(19)21/h2H,1,3-16H2,(H2,19,21)(H,20,22)
InChI key:InChIKey=KCJCDNRXZVJGMM-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCCC(N)=O)(NCCCCC=C)=O
Synonyms:- Dodecanediamide, N1-5-hexen-1-yl-
- Dodecanediamide, N-5-hexenyl-
- N1-5-Hexen-1-yldodecanediamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
