CAS 99769-57-0
:N1-5-Hexen-1-ylhexanediamide
Description:
N1-5-Hexen-1-ylhexanediamide, with the CAS number 99769-57-0, is a chemical compound characterized by its amide functional groups and a hexene chain. This substance features a linear structure, which contributes to its physical and chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on its specific formulation and purity. The presence of both hexene and hexanediamide moieties suggests that it may exhibit amphiphilic characteristics, potentially allowing it to interact with both hydrophilic and hydrophobic environments. This compound may be utilized in various applications, including as a surfactant, in polymer synthesis, or in the formulation of specialty chemicals. Its reactivity can be influenced by the amide bonds, which may participate in hydrogen bonding and other interactions, affecting its solubility and stability. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance. Overall, N1-5-Hexen-1-ylhexanediamide represents a versatile compound with potential utility in multiple fields.
Formula:C12H22N2O2
InChI:InChI=1S/C12H22N2O2/c1-2-3-4-7-10-14-12(16)9-6-5-8-11(13)15/h2H,1,3-10H2,(H2,13,15)(H,14,16)
InChI key:InChIKey=DIFFWVVIHKVXDB-UHFFFAOYSA-N
SMILES:C(C(NCCCCC=C)=O)CCCC(N)=O
Synonyms:- Hexanediamide, N1-5-hexen-1-yl-
- N1-5-Hexen-1-ylhexanediamide
- Hexanediamide, N-5-hexenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
