
CAS 99798-46-6
:Carbamodithioic acid, N,N-diethyl-, (4-ethenylphenyl)methyl ester, homopolymer
Description:
Carbamodithioic acid, N,N-diethyl-, (4-ethenylphenyl)methyl ester, homopolymer, identified by CAS number 99798-46-6, is a synthetic polymer characterized by its unique chemical structure that includes carbamodithioic acid functional groups and vinyl phenyl moieties. This compound typically exhibits properties such as good thermal stability and resistance to various solvents, making it suitable for applications in coatings, adhesives, and sealants. The presence of the diethyl carbamodithioate moiety contributes to its reactivity and potential for cross-linking, enhancing its mechanical properties. Additionally, the polymerization of the vinyl groups allows for the formation of a robust network, which can improve the material's durability and performance in various environments. Its specific characteristics, such as molecular weight and viscosity, can vary depending on the polymerization conditions and the degree of cross-linking achieved. Overall, this compound is of interest in materials science and polymer chemistry for its potential applications in advanced materials.
Formula:(C14H19NS2)x
InChI:InChI=1S/C14H19NS2/c1-4-12-7-9-13(10-8-12)11-17-14(16)15(5-2)6-3/h4,7-10H,1,5-6,11H2,2-3H3
InChI key:InChIKey=YMQKPVAQCHGDGY-UHFFFAOYSA-N
SMILES:C(SC(N(CC)CC)=S)C1=CC=C(C=C)C=C1
Synonyms:- Carbamodithioic acid, diethyl-, (4-ethenylphenyl)methyl ester, homopolymer
- Carbamodithioic acid, N,N-diethyl-, (4-ethenylphenyl)methyl ester, homopolymer
- Poly(4-vinylbenzyl N,N-diethyldithiocarbamate)
- Poly(4-vinylbenzyl diethyldithiocarbamate)
- 4-(N,N-Diethyldithiocarbamylmethyl)styrene homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Carbamodithioic acid, N,N-diethyl-, (4-ethenylphenyl)methyl ester, homopolymer
CAS:Formula:C14H19NS2Molecular weight:265.4374
