
CAS 998-97-0
:Ethyl butanimidate
Description:
Ethyl butanimidate, with the CAS number 998-97-0, is an organic compound characterized by its amide functional group. It is typically a colorless to pale yellow liquid with a distinctive odor. This compound is known for its use in organic synthesis, particularly in the preparation of various pharmaceuticals and agrochemicals. Ethyl butanimidate features a butanimidate backbone, which contributes to its reactivity and ability to participate in various chemical reactions, such as acylation and amidation. It is soluble in organic solvents, making it versatile for laboratory applications. Safety considerations are important when handling this substance, as it may pose health risks if inhaled or ingested, and appropriate protective measures should be taken. Additionally, its stability under standard conditions allows for its use in various synthetic pathways, making it a valuable intermediate in chemical synthesis. Overall, ethyl butanimidate is a significant compound in the field of organic chemistry, with applications that extend to medicinal chemistry and materials science.
Formula:C6H13NO
InChI:InChI=1S/C6H13NO/c1-3-5-6(7)8-4-2/h7H,3-5H2,1-2H3
InChI key:InChIKey=JEZVIUQRUWOXRY-UHFFFAOYSA-N
SMILES:C(CCC)(OCC)=N
Synonyms:- Butanimidic acid, ethyl ester
- Ethyl butyrimidate
- Ethyl butanimidate
- Butyrimidic acid, ethyl ester
- O-Ethyl butyrimidate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.