CAS 99810-76-1

2-tert-butyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane

Description:

2-tert-butyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is a boron-containing organic compound characterized by its unique dioxaborolane ring structure. This compound features a boron atom bonded to two oxygen atoms within a five-membered cyclic structure, which is further substituted with tert-butyl and tetramethyl groups. These substituents contribute to its steric bulk and influence its reactivity and solubility properties. Typically, dioxaborolanes are known for their stability and ability to participate in various chemical reactions, including those involving nucleophiles and electrophiles. The presence of the boron atom allows for potential applications in organic synthesis, particularly in the formation of carbon-boron bonds. Additionally, the compound may exhibit interesting properties such as low volatility and moderate polarity, making it suitable for specific applications in materials science and organic chemistry. Its unique structure and functional groups may also impart specific reactivity patterns, making it a valuable intermediate in synthetic pathways.

Formula: C₁₀H₂₁BO₂

InChI: InChI=1/C10H21BO2/c1-8(2,3)11-12-9(4,5)10(6,7)13-11/h1-7H3

SMILES: CC(C)(C)B1OC(C)(C)C(C)(C)O1

Synonyms:

• tert-Butylboronic acid pinacol ester

2-(tert-Butyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane

CAS: 99810-76-1

Formula: C₁₀H₂₁BO₂

Purity: 97%

Color and Shape: Liquid

Molecular weight: 184.0835

Ref: IN-DA003ULK

tert-Butylboronic acid, pinacol ester

CAS: 99810-76-1

tert-Butylboronic acid, pinacol ester

Formula: C₁₀H₂₁BO₂

Purity: 97%

Color and Shape: clear. colourless liquid

Molecular weight: 184.08g/mol

Ref: 54-OR9319

tert-Butylboronic acid pinacol ester

CAS: 99810-76-1

Purity: 98%

Molecular weight: 184.09

Ref: FT-B1537

tert-Butylboronic acid pinacol ester

CAS: 99810-76-1

tert-Butylboronic acid pinacol ester is a fine chemical reagent that is used as a building block in the synthesis of complex compounds. It is an intermediate in reactions involving the conversion of alcohols to esters with the use of acid catalysts. Tert-butylboronic acid pinacol ester has been shown to be a useful scaffold for organic synthesis, and can be used as a high quality reaction component. It also has applications as a research chemical and speciality chemical.

Formula: C₁₀H₂₁BO₂

Purity: Min. 95%

Color and Shape: Clear Liquid

Molecular weight: 184.08 g/mol

Ref: 3D-FB153689

2-(tert-Butyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane

CAS: 99810-76-1

Formula: C₁₀H₂₁BO₂

Purity: 95%

Color and Shape: Liquid

Molecular weight: 184.09

Ref: 10-F228819