CAS 99810-76-1
:2-tert-butyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Description:
2-tert-butyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is a boron-containing organic compound characterized by its unique dioxaborolane ring structure. This compound features a boron atom bonded to two oxygen atoms within a five-membered cyclic structure, which is further substituted with tert-butyl and tetramethyl groups. These substituents contribute to its steric bulk and influence its reactivity and solubility properties. Typically, dioxaborolanes are known for their stability and ability to participate in various chemical reactions, including those involving nucleophiles and electrophiles. The presence of the boron atom allows for potential applications in organic synthesis, particularly in the formation of carbon-boron bonds. Additionally, the compound may exhibit interesting properties such as low volatility and moderate polarity, making it suitable for specific applications in materials science and organic chemistry. Its unique structure and functional groups may also impart specific reactivity patterns, making it a valuable intermediate in synthetic pathways.
Formula:C10H21BO2
InChI:InChI=1/C10H21BO2/c1-8(2,3)11-12-9(4,5)10(6,7)13-11/h1-7H3
SMILES:CC(C)(C)B1OC(C)(C)C(C)(C)O1
Synonyms:- tert-Butylboronic acid pinacol ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-(tert-Butyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
CAS:Formula:C10H21BO2Purity:97%Color and Shape:LiquidMolecular weight:184.0835tert-Butylboronic acid, pinacol ester
CAS:tert-Butylboronic acid, pinacol esterFormula:C10H21BO2Purity:97%Color and Shape: clear. colourless liquidMolecular weight:184.08g/moltert-Butylboronic acid pinacol ester
CAS:tert-Butylboronic acid pinacol ester is a fine chemical reagent that is used as a building block in the synthesis of complex compounds. It is an intermediate in reactions involving the conversion of alcohols to esters with the use of acid catalysts. Tert-butylboronic acid pinacol ester has been shown to be a useful scaffold for organic synthesis, and can be used as a high quality reaction component. It also has applications as a research chemical and speciality chemical.Formula:C10H21BO2Purity:Min. 95%Color and Shape:Clear LiquidMolecular weight:184.08 g/mol2-(tert-Butyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
CAS:Formula:C10H21BO2Purity:95%Color and Shape:LiquidMolecular weight:184.09




