
CAS 99810-77-2
:2-(1,1,2-Trimethylpropyl)-1,3,2-dioxaborolane
Description:
2-(1,1,2-Trimethylpropyl)-1,3,2-dioxaborolane is a boron-containing organic compound characterized by its unique dioxaborolane ring structure, which features a five-membered cyclic arrangement containing two oxygen atoms and one boron atom. This compound is typically colorless to pale yellow and may exhibit a mild odor. It is soluble in organic solvents, making it useful in various chemical reactions, particularly in organic synthesis and as a reagent in the formation of carbon-boron bonds. The presence of the 1,1,2-trimethylpropyl group contributes to its hydrophobic nature and steric bulk, influencing its reactivity and interactions with other molecules. Additionally, compounds like this one are often studied for their potential applications in materials science, catalysis, and pharmaceuticals. Safety data indicates that, like many organoboron compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, 2-(1,1,2-trimethylpropyl)-1,3,2-dioxaborolane is a significant compound in the field of synthetic organic chemistry.
Formula:C8H17BO2
InChI:InChI=1S/C8H17BO2/c1-7(2)8(3,4)9-10-5-6-11-9/h7H,5-6H2,1-4H3
InChI key:InChIKey=COBCWQFBNKNIAQ-UHFFFAOYSA-N
SMILES:C(C(C)C)(C)(C)B1OCCO1
Synonyms:- 2-(2,3-Dimethylbutan-2-yl)-1,3,2-dioxaborolane
- 2-(1,1,2-Trimethylpropyl)-1,3,2-dioxaborolane
- 2-Thexyl-1,3,2-dioxaborolane
- 1,3,2-Dioxaborolane, 2-(1,1,2-trimethylpropyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
