CAS 99817-37-5
:6-Amino-2,4-dichloro-3-ethylphenol
Description:
6-Amino-2,4-dichloro-3-ethylphenol is an organic compound characterized by its phenolic structure, which includes an amino group and two chlorine substituents on the aromatic ring. The presence of the amino group (-NH2) indicates that it can participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions. The dichloro substituents at the 2 and 4 positions contribute to the compound's reactivity and influence its physical properties, such as solubility and boiling point. The ethyl group at the 3 position adds to the steric bulk and can affect the compound's overall polarity. This compound may be used in various applications, including as an intermediate in the synthesis of dyes, pharmaceuticals, or agrochemicals. Safety data should be consulted, as halogenated compounds can exhibit toxicity and environmental persistence. Proper handling and disposal procedures are essential to mitigate any potential risks associated with its use.
Formula:C8H9Cl2NO
InChI:InChI=1S/C8H9Cl2NO/c1-2-4-5(9)3-6(11)8(12)7(4)10/h3,12H,2,11H2,1H3
InChI key:InChIKey=QMRQXLFENCRBNZ-UHFFFAOYSA-N
SMILES:C(C)C1=C(Cl)C(O)=C(N)C=C1Cl
Synonyms:- 6-Amino-2,4-dichloro-3-ethylphenol
- Phenol, 6-amino-2,4-dichloro-3-ethyl-
- 2-Amino-4,6-dichloro-5-ethylphenol
- 3,5-Dichloro-4-ethyl-2-hydroxyaniline
- 2,4-Dichloro-3-ethyl-6-aminophenol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
