
CAS 99817-43-3
:5-[(6-Methyloctyl)oxy]-2-[[(4-octylphenyl)imino]methyl]phenol
Description:
5-[(6-Methyloctyl)oxy]-2-[[(4-octylphenyl)imino]methyl]phenol, with the CAS number 99817-43-3, is an organic compound characterized by its complex structure, which includes a phenolic group, an imine linkage, and a long alkyl chain. This compound typically exhibits properties associated with both hydrophobic and hydrophilic regions due to the presence of the alkyl chains and the phenolic hydroxyl group. It is likely to be a solid at room temperature, with potential applications in materials science, particularly in the formulation of surfactants or as an additive in polymer chemistry. The presence of the imine functional group suggests potential reactivity, making it useful in various chemical reactions, including condensation and polymerization processes. Additionally, the compound's structure may impart specific optical or electronic properties, which could be advantageous in applications such as organic electronics or photonics. However, detailed safety and handling information should be consulted, as the toxicity and environmental impact of such compounds can vary significantly.
Formula:C30H45NO2
InChI:InChI=1S/C30H45NO2/c1-4-6-7-8-9-12-15-26-16-19-28(20-17-26)31-24-27-18-21-29(23-30(27)32)33-22-13-10-11-14-25(3)5-2/h16-21,23-25,32H,4-15,22H2,1-3H3
InChI key:InChIKey=MZGHKLCNTFASNJ-UHFFFAOYSA-N
SMILES:C(=NC1=CC=C(CCCCCCCC)C=C1)C2=C(O)C=C(OCCCCCC(CC)C)C=C2
Synonyms:- 5-[(6-Methyloctyl)oxy]-2-[[(4-octylphenyl)imino]methyl]phenol
- Phenol, 5-[(6-methyloctyl)oxy]-2-[[(4-octylphenyl)imino]methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Phenol, 5-[(6-methyloctyl)oxy]-2-[[(4-octylphenyl)imino]methyl]-
CAS:Formula:C30H45NO2Molecular weight:451.6838
