CAS 99834-92-1
:methyl 2-{4-[(5-propanoylfuran-2-yl)oxy]phenyl}propanoate
Description:
Methyl 2-{4-[(5-propanoylfuran-2-yl)oxy]phenyl}propanoate, with the CAS number 99834-92-1, is an organic compound characterized by its ester functional group, which is typical of methyl esters. This compound features a furan ring, a five-membered aromatic structure that contributes to its reactivity and potential biological activity. The presence of the propanoyl group indicates that it may exhibit properties associated with carbonyl compounds, such as reactivity in nucleophilic addition reactions. The phenyl group attached to the furan enhances its aromatic character, potentially influencing its solubility and stability. Additionally, the methyl ester group suggests that it may be involved in various chemical reactions, including hydrolysis and transesterification. Overall, this compound's structure suggests potential applications in pharmaceuticals, agrochemicals, or as a synthetic intermediate, although specific biological activities or applications would require further investigation. Its unique combination of functional groups may also impart interesting physical properties, such as melting and boiling points, which are essential for practical applications.
Formula:C17H18O5
InChI:InChI=1/C17H18O5/c1-4-14(18)15-9-10-16(22-15)21-13-7-5-12(6-8-13)11(2)17(19)20-3/h5-11H,4H2,1-3H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
METHYL 2-[4-[(5-PROPANOYL-2-FURYL)OXY]PHENYL]PROPANOATE
CAS:Formula:C17H18O5Molecular weight:302.3218
