CAS 99835-27-5

4-Bromo-2,6-dichlorobenzonitrile

Description:

4-Bromo-2,6-dichlorobenzonitrile is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with bromine and chlorine atoms, as well as a nitrile functional group. The presence of the bromine and chlorine substituents contributes to its reactivity and potential applications in various chemical reactions, particularly in the synthesis of pharmaceuticals and agrochemicals. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests that it may participate in electrophilic aromatic substitution reactions due to the electron-withdrawing nature of the nitrile group. Additionally, the presence of halogens can influence its physical properties, such as melting and boiling points, as well as its overall stability. Safety data indicates that, like many halogenated compounds, it should be handled with care due to potential toxicity and environmental concerns. Proper safety measures, including the use of personal protective equipment, are recommended when working with this substance.

Formula: C₇H₂BrCl₂N

InChI: InChI=1S/C7H2BrCl2N/c8-4-1-6(9)5(3-11)7(10)2-4/h1-2H

SMILES: c1c(cc(c(C#N)c1Cl)Cl)Br

Synonyms:

• Benzonitrile, 4-bromo-2,6-dichloro-
• 4-Bromo-2,6-dichlorobenzonitrile

Benzonitrile, 4-bromo-2,6-dichloro-

CAS: 99835-27-5

Formula: C₇H₂BrCl₂N

Purity: 95%

Color and Shape: Solid

Molecular weight: 250.9075

Ref: IN-DA00IKC5

4-Bromo-2,6-dichlorobenzonitrile

CAS: 99835-27-5

4-Bromo-2,6-dichlorobenzonitrile

Purity: 98%

Molecular weight: 250.91g/mol

Ref: 54-OR75461

4-Bromo-2,6-dichlorobenzonitrile

CAS: 99835-27-5

Formula: C₇H₂BrCl₂N

Purity: 95%

Color and Shape: Solid

Molecular weight: 250.9

Ref: 10-F069708

4-Bromo-2,6-dichlorobenzonitrile

CAS: 99835-27-5

Versatile small molecule scaffold

Formula: C₇H₂BrCl₂N

Purity: Min. 95%

Molecular weight: 250.9 g/mol

Ref: 3D-ZDA83527