CymitQuimica logo

CAS 99839-26-6

:

1,4,5,6-Tetrahydro-2-pyridinecarboxylic acid

Description:
1,4,5,6-Tetrahydro-2-pyridinecarboxylic acid is a heterocyclic organic compound characterized by its pyridine ring structure, which is partially saturated. This compound features a carboxylic acid functional group, contributing to its acidic properties. It is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the carboxylic acid group. The compound is of interest in various fields, including medicinal chemistry, due to its potential biological activities and applications in drug development. Its molecular structure allows for various chemical modifications, which can enhance its pharmacological properties. Additionally, it may participate in various chemical reactions, such as esterification and amidation, making it a versatile intermediate in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, 1,4,5,6-Tetrahydro-2-pyridinecarboxylic acid is a significant compound in both research and industrial applications.
Formula:C6H9NO2
InChI:InChI=1S/C6H9NO2/c8-6(9)5-3-1-2-4-7-5/h3,7H,1-2,4H2,(H,8,9)
InChI key:InChIKey=SYHALQNMKJVYAZ-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CCCCN1
Synonyms:
  • α,β-Dehydropipecolic acid
  • 1,4,5,6-Tetrahydro-2-pyridinecarboxylic acid
  • Picolinic acid, 1,4,5,6-tetrahydro-
  • 2-Pyridinecarboxylic acid, 1,4,5,6-tetrahydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.