CAS 99842-68-9
:Acetic acid, 2-cyano-, 2-phenylethyl ester
Description:
Acetic acid, 2-cyano-, 2-phenylethyl ester, with the CAS number 99842-68-9, is an organic compound characterized by its ester functional group. This compound features a cyano group (-CN) and a phenylethyl moiety, which contribute to its chemical properties and reactivity. It is typically a colorless to pale yellow liquid with a distinctive odor. The presence of the cyano group imparts polar characteristics, making the compound soluble in polar solvents. Acetic acid derivatives often exhibit moderate to high boiling points due to intermolecular hydrogen bonding. This compound may be used in organic synthesis, particularly in the preparation of pharmaceuticals and agrochemicals, owing to its potential as a building block in various chemical reactions. Additionally, its reactivity can be influenced by the electron-withdrawing nature of the cyano group, which can affect nucleophilic attack during chemical transformations. Safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C11H11NO2
InChI:InChI=1S/C11H11NO2/c12-8-6-11(13)14-9-7-10-4-2-1-3-5-10/h1-5H,6-7,9H2
InChI key:InChIKey=NZMIRLKHMFERSX-UHFFFAOYSA-N
SMILES:C(COC(CC#N)=O)C1=CC=CC=C1
Synonyms:- Acetic acid, cyano-, 2-phenylethyl ester
- Acetic acid, 2-cyano-, 2-phenylethyl ester
- Acetic acid, cyano-, phenethyl ester
- 2-Phenylethyl 2-cyanoacetate
- 2-Phenylethyl cyanoacetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
