CAS 99844-02-7
:2-Amino-4-(4-methoxyphenyl)pyrimidine
Description:
2-Amino-4-(4-methoxyphenyl)pyrimidine is an organic compound characterized by its pyrimidine ring, which is a six-membered heterocyclic structure containing two nitrogen atoms at positions 1 and 3. This compound features an amino group (-NH2) at the 2-position and a para-substituted methoxyphenyl group at the 4-position, contributing to its unique chemical properties. The presence of the methoxy group enhances its lipophilicity and can influence its reactivity and biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the amino group. It is of interest in medicinal chemistry for its potential applications in pharmaceuticals, particularly in the development of compounds with antimicrobial or anticancer properties. The molecular structure allows for various interactions, including hydrogen bonding, which can be crucial for its biological activity. As with many organic compounds, proper handling and storage are essential to maintain its stability and efficacy.
Formula:C11H11N3O
InChI:InChI=1/C11H11N3O/c1-15-9-4-2-8(3-5-9)10-6-7-13-11(12)14-10/h2-7H,1H3,(H2,12,13,14)
SMILES:COc1ccc(cc1)c1cc[nH]c(=N)n1
Synonyms:- 2-Pyrimidinamine, 4-(4-Methoxyphenyl)-
- 4-(4-Methoxyphenyl)Pyrimidin-2-Amine
- 4-amino-4-(4-Methoxyphenyl)-Pyrimidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-(4-Methoxyphenyl)pyrimidin-2-amine
CAS:Formula:C11H11N3OPurity:97%Color and Shape:SolidMolecular weight:201.22454-(4-Methoxyphenyl)pyrimidin-2-amine
CAS:4-(4-Methoxyphenyl)pyrimidin-2-aminePurity:≥95%Color and Shape:PowderMolecular weight:201.22g/mol2-Amino-4-(4-methoxyphenyl)pyrimidine
CAS:2-Amino-4-(4-methoxyphenyl)pyrimidine (AMP) is a synthetic nucleoside analog. It has antiviral activity and is used for the treatment of hepatitis B virus infection. AMP inhibits viral DNA polymerase and prevents the synthesis of viral DNA and RNA. It has been modified to include a methoxy group at the 4 position, which provides additional stability against the enzyme ribonuclease. AMP is also an activator of ribonucleotide reductase and can be used as a substrate to synthesize deoxyribonucleosides, phosphoramidites, diphosphate, or monophosphate nucleotides for DNA synthesis.
AMP has CAS number 99844-02-7 and is available in high purity.Formula:C11H11N3OPurity:Min. 95%Molecular weight:201.22 g/mol



