CymitQuimica logo

CAS 99860-36-3

:

6-(chloromethyl)-N-(4-methylphenyl)-1,3,5-triazine-2,4-diamine

Description:
6-(Chloromethyl)-N-(4-methylphenyl)-1,3,5-triazine-2,4-diamine, with the CAS number 99860-36-3, is a chemical compound that belongs to the class of triazine derivatives. This substance features a triazine ring, which is a six-membered heterocyclic compound containing three nitrogen atoms and three carbon atoms. The presence of a chloromethyl group indicates that it has a reactive site that can participate in further chemical reactions, making it useful in various synthetic applications. The N-(4-methylphenyl) substituent suggests that the compound has an aromatic character, which can influence its solubility and reactivity. Generally, triazine derivatives are known for their applications in agrochemicals, pharmaceuticals, and as intermediates in organic synthesis. The specific properties such as solubility, melting point, and reactivity can vary based on the molecular structure and substituents, but detailed information would typically be found in specialized chemical databases or literature. Safety data and handling precautions should also be considered when working with this compound, as with any chemical substance.
Formula:C11H12ClN5
InChI:InChI=1/C11H12ClN5/c1-7-2-4-8(5-3-7)14-11-16-9(6-12)15-10(13)17-11/h2-5H,6H2,1H3,(H3,13,14,15,16,17)
SMILES:Cc1ccc(cc1)Nc1nc(CCl)nc(=N)[nH]1
Synonyms:
  • 1,3,5-triazine-2,4-diamine, 6-(chloromethyl)-N~2~-(4-methylphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.