
CAS 99869-39-3
:2-(Chlorodimethylsilyl)-2-propen-1-yl 2-propenoate
Description:
2-(Chlorodimethylsilyl)-2-propen-1-yl 2-propenoate, with the CAS number 99869-39-3, is an organosilicon compound characterized by the presence of a chlorodimethylsilyl group attached to a propenyl moiety. This compound typically exhibits a clear to pale yellow liquid form and has a moderate volatility. It is known for its reactivity, particularly in polymerization processes, where it can participate in addition reactions due to the presence of the vinyl groups. The chlorodimethylsilyl group enhances its ability to bond with various substrates, making it useful in applications such as surface modification and as a coupling agent in the synthesis of silicone-based materials. Additionally, the compound may exhibit properties such as low surface tension and good thermal stability, which are advantageous in industrial applications. Safety considerations should be taken into account, as it may be hazardous due to the presence of chlorine and its potential reactivity. Proper handling and storage conditions are essential to ensure safety and stability.
Formula:C8H13ClO2Si
InChI:InChI=1S/C8H13ClO2Si/c1-5-8(10)11-6-7(2)12(3,4)9/h5H,1-2,6H2,3-4H3
InChI key:InChIKey=KDFFDVVANRQRFV-UHFFFAOYSA-N
SMILES:C([Si](C)(C)Cl)(COC(C=C)=O)=C
Synonyms:- 2-Propenoic acid, 2-(chlorodimethylsilyl)-2-propen-1-yl ester
- 2-Propenoic acid, 2-(chlorodimethylsilyl)-2-propenyl ester
- 2-(Chlorodimethylsilyl)-2-propen-1-yl 2-propenoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
[(Z)-prop-1-enyl] 2-(chloro-dimethyl-silyl)prop-2-enoate
CAS:Formula:C8H13ClO2SiMolecular weight:204.7261
