CAS 99878-77-0
:7,8-Dimethoxy-4-quinolinamine
Description:
7,8-Dimethoxy-4-quinolinamine is an organic compound characterized by its quinoline structure, which consists of a bicyclic aromatic system containing a nitrogen atom. This compound features two methoxy groups (-OCH3) attached to the 7 and 8 positions of the quinoline ring, contributing to its chemical properties and reactivity. The presence of the amino group (-NH2) at the 4-position enhances its potential for hydrogen bonding and reactivity in various chemical reactions. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its solubility, stability, and reactivity can be influenced by the methoxy and amino substituents, which can affect its interaction with biological targets. Additionally, the compound's molecular structure suggests potential applications in dye synthesis, as well as in the development of pharmaceuticals. As with many quinoline derivatives, it may also possess fluorescent properties, which can be useful in various analytical techniques. Safety and handling precautions should be observed due to the potential toxicity associated with nitrogen-containing heterocycles.
Formula:C11H12N2O2
InChI:InChI=1S/C11H12N2O2/c1-14-9-4-3-7-8(12)5-6-13-10(7)11(9)15-2/h3-6H,1-2H3,(H2,12,13)
InChI key:InChIKey=SYTHKTKWSHBYKQ-UHFFFAOYSA-N
SMILES:O(C)C=1C2=C(C=CC1OC)C(N)=CC=N2
Synonyms:- 4-Amino-7,8-dimethoxyquinoline
- 4-Quinolinamine, 7,8-dimethoxy-
- 7,8-Dimethoxy-4-quinolinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
