
CAS 99878-79-2
:4-Chloro-7,8-dimethoxyquinoline
Description:
4-Chloro-7,8-dimethoxyquinoline is an organic compound belonging to the quinoline family, characterized by a bicyclic structure that includes a benzene ring fused to a pyridine ring. This compound features a chlorine atom at the 4-position and two methoxy groups at the 7 and 8 positions, which significantly influence its chemical properties and reactivity. It is typically a yellow to brown solid, with moderate solubility in organic solvents. The presence of the chlorine and methoxy groups can enhance its biological activity, making it of interest in medicinal chemistry, particularly for its potential antimicrobial and anticancer properties. The compound's molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can affect its behavior in biological systems. Additionally, 4-Chloro-7,8-dimethoxyquinoline may undergo typical reactions associated with quinolines, such as electrophilic substitution and nucleophilic attack, making it a versatile building block in organic synthesis. Safety and handling precautions should be observed due to its potential toxicity and environmental impact.
Formula:C11H10ClNO2
InChI:InChI=1S/C11H10ClNO2/c1-14-9-4-3-7-8(12)5-6-13-10(7)11(9)15-2/h3-6H,1-2H3
InChI key:InChIKey=CILQDBAXEWYDIH-UHFFFAOYSA-N
SMILES:O(C)C=1C2=C(C=CC1OC)C(Cl)=CC=N2
Synonyms:- NSC 382169
- 4-Chloro-7,8-dimethoxyquinoline
- Quinoline, 4-chloro-7,8-dimethoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
