
CAS 99886-26-7
:9-Octadecyl-9-phosphabicyclo[4.2.1]nonane
Description:
9-Octadecyl-9-phosphabicyclo[4.2.1]nonane, identified by its CAS number 99886-26-7, is a chemical compound that features a bicyclic structure incorporating a phosphorus atom. This compound is characterized by its long hydrophobic octadecyl chain, which contributes to its amphiphilic nature, making it potentially useful in various applications such as surfactants or in materials science. The bicyclic framework provides unique steric and electronic properties, influencing its reactivity and interactions with other molecules. Typically, compounds of this type exhibit stability under a range of conditions, although their specific reactivity can vary based on the surrounding environment and functional groups present. The presence of phosphorus in the structure may also impart specific catalytic or coordination properties, making it of interest in organophosphorus chemistry. Overall, 9-Octadecyl-9-phosphabicyclo[4.2.1]nonane represents a unique class of compounds that can be explored for various industrial and research applications.
Formula:C26H51P
InChI:InChI=1S/C26H51P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19-24-27-25-20-17-18-21-26(27)23-22-25/h25-26H,2-24H2,1H3
InChI key:InChIKey=RHBPCOITPOBTBL-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCCCCCCCCC)P1C2CCC1CCCC2
Synonyms:- 9-Octadecyl-9-phosphabicyclo[4.2.1]nonane
- 9-Phosphabicyclo[4.2.1]nonane, 9-octadecyl-
- 9-Octadecyl-9-phospha[4.2.1]bicyclononane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
