CAS 99886-27-8
:2-Octanol, 2,6-dimethyl-, 2-propanoate
Description:
2-Octanol, 2,6-dimethyl-, 2-propanoate, with the CAS number 99886-27-8, is an ester compound characterized by its fruity odor and is often used in flavoring and fragrance applications. This substance is derived from the reaction of 2-octanol and propanoic acid, resulting in a structure that features a long hydrocarbon chain, contributing to its hydrophobic properties. It is typically a colorless to pale yellow liquid at room temperature and is soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. The compound exhibits moderate volatility and can be flammable, necessitating careful handling. Its chemical properties include the ability to undergo hydrolysis in the presence of water or acids, breaking down into its constituent alcohol and acid. Additionally, it may participate in various chemical reactions typical of esters, such as transesterification. Overall, 2-Octanol, 2,6-dimethyl-, 2-propanoate is notable for its applications in the food and cosmetic industries, where it contributes to desirable scents and flavors.
Formula:C13H26O2
InChI:InChI=1S/C13H26O2/c1-6-11(3)9-8-10-13(4,5)15-12(14)7-2/h11H,6-10H2,1-5H3
InChI key:InChIKey=UXAGANHTCDZALK-UHFFFAOYSA-N
SMILES:O(C(CCCC(CC)C)(C)C)C(CC)=O
Synonyms:- 2-Octanol, 2,6-dimethyl-, 2-propanoate
- 2-Octanol, 2,6-dimethyl-, propanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
