CAS 99886-31-4
:5-oxoprolyl-L-leucyl-L-threonyl-L-phenylalanyl-L-threonyl-L-seryl-L-seryl-L-tryptophylglycinamide
Description:
The chemical substance known as "5-oxoprolyl-L-leucyl-L-threonyl-L-phenylalanyl-L-threonyl-L-seryl-L-seryl-L-tryptophylglycinamide," with the CAS number 99886-31-4, is a peptide that consists of a sequence of amino acids. Its structure includes a 5-oxoproline moiety, which is a cyclic derivative of proline, and a chain of various L-amino acids, including leucine, threonine, phenylalanine, serine, tryptophan, and glycine. This peptide is characterized by its potential biological activity, which may include roles in signaling pathways or interactions with specific receptors. The presence of multiple L-amino acids suggests that it may exhibit specific conformational properties and biological functions, such as enzyme inhibition or modulation of physiological processes. Additionally, the peptide's hydrophilicity or hydrophobicity can influence its solubility and interaction with biological membranes. Overall, this compound may be of interest in biochemical research and pharmaceutical applications, particularly in the study of peptide-based therapeutics.
Formula:C47H65N11O14
InChI:InChI=1/C47H65N11O14/c1-23(2)16-31(52-41(66)30-14-15-37(64)51-30)42(67)57-38(24(3)61)46(71)54-32(17-26-10-6-5-7-11-26)43(68)58-39(25(4)62)47(72)56-35(22-60)45(70)55-34(21-59)44(69)53-33(40(65)50-20-36(48)63)18-27-19-49-29-13-9-8-12-28(27)29/h5-13,19,23-25,30-35,38-39,49,59-62H,14-18,20-22H2,1-4H3,(H2,48,63)(H,50,65)(H,51,64)(H,52,66)(H,53,69)(H,54,71)(H,55,70)(H,56,72)(H,57,67)(H,58,68)/t24-,25-,30?,31+,32+,33+,34+,35+,38+,39+/m1/s1
Synonyms:- Pyr-Leu-Thr-Phe-Thr-Ser-Ser-Trp-Gly-Nh2
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Adipokinetic Hormone (Apis mellifera ligustica, Bombyx mori, Heliothis zea, Manduca sexta)
CAS:AKH, a peptide hormone which stimulates synthesis of 1,2-diacyl-sn-glycerols in the Manduca sexta fat body.Formula:C47H65N11O14Purity:95.8%Molecular weight:1008.1Adipokinetic Hormone (Apis mellifera ligustica) TFA salt
CAS:<p>Adipokinetic hormone is a peptide hormone that has been shown to stimulate the metabolism of fat cells in laboratory animals. This peptide is produced by the gland cells of honeybees and is used to regulate the energy metabolism of honeybees and other insects. Adipokinetic hormone has been shown to increase locomotor activity, inhibit the growth of human pathogens, activate transfer reactions, and inhibit receptor activity. The biological properties of this hormone have not yet been fully elucidated.</p>Formula:C47H65N11O14•C2HF3O2Purity:Min. 95 Area-%Color and Shape:PowderMolecular weight:1,122.10 g/mol

