CAS 99896-05-6: trans,trans-2-Fluor-4-(4-pentylcyclohexyl)-4'-(4-propyl-cyclohexyl)-1,1'-biphenyl
Description:Trans,trans-2-Fluor-4-(4-pentylcyclohexyl)-4'-(4-propyl-cyclohexyl)-1,1'-biphenyl is a complex organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of fluorine in the molecule introduces unique electronic properties, potentially affecting its reactivity and interactions. The compound features long aliphatic side chains, specifically pentyl and propyl groups, which contribute to its hydrophobic characteristics and influence its solubility in various solvents. The trans configuration of the substituents is significant for its spatial arrangement, impacting its physical properties such as melting and boiling points, as well as its potential applications in materials science, particularly in liquid crystal technologies. Additionally, the compound's structural complexity may lead to interesting optical properties, making it a candidate for research in photonic applications. Overall, this substance exemplifies the intricate relationship between molecular structure and functional properties in organic chemistry.
Formula:C32H45F
InChI:InChI=1/C32H45F/c1-3-5-6-8-25-11-13-26(14-12-25)27-17-19-29(20-18-27)31-22-21-30(23-32(31)33)28-15-9-24(7-4-2)10-16-28/h17-26,28H,3-16H2,1-2H3

trans,trans-2-Fluor-4-(4-pentylcyclohexyl)-4-(4-propyl-cyclohexyl)-1,1-biphenyl
Ref: IN-DA019EQ9
1g | 26.00 € | ||
5g | 68.00 € | ||
10g | 117.00 € |

Trans,trans-2-Fluor-4-(4-pentylcyclohexyl)-4-(4-propyl-cyclohexyl)-1,1-biphenyl
Ref: 10-F987574
5g | 58.00 € | ||
10g | 76.00 € |

2-Fluoro-4'-(4-pentylcyclohexyl)-4-(4-propylcyclohexyl)biphenyl
Ref: 3D-FF97249
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
500mg | Discontinued | Request information |