CymitQuimica logo

CAS 999-34-8

:

Phosphonodithious acid, methyl-, dipropyl ester

Description:
Phosphonodithious acid, methyl-, dipropyl ester, identified by the CAS number 999-34-8, is an organophosphorus compound characterized by its ester functional groups and the presence of phosphorus in its structure. This compound typically exhibits properties associated with organophosphorus esters, such as moderate to low volatility and potential solubility in organic solvents. It may possess a distinct odor and is likely to be sensitive to hydrolysis, especially in the presence of moisture, leading to the release of the corresponding acids. The presence of sulfur in its structure suggests potential reactivity and applications in various chemical processes, including as a reagent or intermediate in organic synthesis. Additionally, due to its phosphorus content, it may exhibit biological activity, which could be relevant in agricultural or pharmaceutical contexts. Safety considerations are essential, as organophosphorus compounds can have toxicological implications, necessitating careful handling and storage. Overall, this compound's unique structural features contribute to its potential utility in diverse chemical applications.
Formula:C7H17PS2
InChI:InChI=1S/C7H17PS2/c1-4-6-9-8(3)10-7-5-2/h4-7H2,1-3H3
InChI key:InChIKey=HKDYILGABRVNTF-UHFFFAOYSA-N
SMILES:P(SCCC)(SCCC)C
Synonyms:
  • Phosphonodithious acid, methyl-, dipropyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.