CAS 999-52-0
:3-Chloroheptane
Description:
3-Chloroheptane is an organic compound classified as a haloalkane, specifically a chlorinated derivative of heptane. Its molecular formula is C7H15Cl, indicating it consists of seven carbon atoms, fifteen hydrogen atoms, and one chlorine atom. This compound is characterized by a straight-chain structure with the chlorine atom attached to the third carbon in the heptane chain, which influences its physical and chemical properties. 3-Chloroheptane is typically a colorless liquid at room temperature and has a relatively low boiling point compared to larger chlorinated hydrocarbons. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. The presence of the chlorine atom makes it reactive, particularly in nucleophilic substitution reactions, and it can serve as an intermediate in organic synthesis. Additionally, 3-chloroheptane may pose environmental and health risks, necessitating careful handling and disposal in accordance with safety regulations.
Formula:C7H15Cl
InChI:InChI=1S/C7H15Cl/c1-3-5-6-7(8)4-2/h7H,3-6H2,1-2H3
InChI key:InChIKey=DMKNOEJJJSHSML-UHFFFAOYSA-N
SMILES:C(CCCC)(CC)Cl
Synonyms:- 3-Chloroheptane
- Heptane, 3-chloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
