CAS 999-64-4
:3-Bromooctane
Description:
3-Bromooctane is an organic compound classified as a haloalkane, specifically an alkyl bromide. It features a straight-chain structure with a bromine atom attached to the third carbon of an octane chain, giving it the molecular formula C8H17Br. This compound is typically a colorless to pale yellow liquid at room temperature and possesses a characteristic odor. 3-Bromooctane is soluble in organic solvents but has limited solubility in water due to its hydrophobic alkyl chain. It is primarily used in organic synthesis as a reagent for the introduction of bromine into organic molecules and can serve as an intermediate in the production of various chemicals. The presence of the bromine atom makes it a potential candidate for nucleophilic substitution reactions. Additionally, 3-Bromooctane is subject to regulations regarding its environmental impact and safety, as halogenated compounds can pose risks to human health and ecosystems. Proper handling and disposal are essential to mitigate any potential hazards associated with its use.
Formula:C8H17Br
InChI:InChI=1S/C8H17Br/c1-3-5-6-7-8(9)4-2/h8H,3-7H2,1-2H3
InChI key:InChIKey=OELHQHILWOIUSL-UHFFFAOYSA-N
SMILES:C(CCCCC)(CC)Br
Synonyms:- 3-Octyl bromide
- 3-Bromooctane
- Octane, 3-bromo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
