CAS 999-65-5
:1-(1-Methylpropoxy)butane
Description:
1-(1-Methylpropoxy)butane, with the CAS number 999-65-5, is an organic compound classified as an ether. It features a butane backbone with a 1-methylpropoxy group attached, which contributes to its unique properties. This substance is typically a colorless liquid at room temperature and is known for its relatively low viscosity. It has a moderate boiling point and is generally less dense than water. The presence of the ether functional group imparts certain characteristics, such as moderate polarity, which influences its solubility in various organic solvents. 1-(1-Methylpropoxy)butane is often used in chemical synthesis and as a solvent in various applications due to its ability to dissolve a range of organic compounds. Additionally, it may exhibit low toxicity, making it suitable for use in certain industrial processes. However, like many organic solvents, it should be handled with care to avoid inhalation or prolonged skin contact. Proper safety measures should be observed when working with this compound in laboratory or industrial settings.
Formula:C8H18O
InChI:InChI=1S/C8H18O/c1-4-6-7-9-8(3)5-2/h8H,4-7H2,1-3H3
InChI key:InChIKey=LPVMPBNUHJKNHA-UHFFFAOYSA-N
SMILES:C(OCCCC)(CC)C
Synonyms:- 1-(1-Methylpropoxy)butane
- 1-Butan-2-yloxybutane
- 1-sec-Butoxybutane
- Butane, 1-(1-Methylpropoxy)-
- Butyl 2-butyl ether
- Butyl sec-butyl ether
- Ether, butyl sec-butyl
- n-Butyl sec-butyl ether
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
