CymitQuimica logo

CAS 999-68-8

:

methyl (2-carbamoylhydrazinylidene)acetate

Description:
Methyl (2-carbamoylhydrazinylidene)acetate, with the CAS number 999-68-8, is an organic compound characterized by its unique structural features, which include a methyl ester group and a hydrazine derivative. This compound typically exhibits properties associated with both hydrazine and carboxylic acid derivatives, making it a versatile intermediate in organic synthesis. It is likely to be a solid at room temperature, with potential solubility in polar organic solvents due to the presence of functional groups that can engage in hydrogen bonding. The compound may display reactivity typical of hydrazines, such as nucleophilic behavior, and can participate in various chemical reactions, including condensation and substitution reactions. Additionally, its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the hydrazine moiety, which is often associated with bioactive compounds. Safety data should be consulted for handling, as hydrazine derivatives can be hazardous.
Formula:C4H7N3O3
InChI:InChI=1/C4H7N3O3/c1-10-3(8)2-6-7-4(5)9/h2H,1H3,(H3,5,7,9)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.