CAS 99900-95-5
:cycloheptyl 3-(aziridin-1-yl)propanoate
Description:
Cycloheptyl 3-(aziridin-1-yl)propanoate is an organic compound characterized by its unique structure, which includes a cycloheptyl group and an aziridine moiety. The cycloheptyl group contributes to the compound's cyclic structure, providing rigidity and influencing its steric properties. The aziridine ring, a three-membered nitrogen-containing heterocycle, is known for its reactivity, particularly in nucleophilic and electrophilic reactions, making this compound potentially useful in synthetic organic chemistry. The propanoate functional group indicates the presence of an ester, which can affect the compound's solubility and reactivity. Cycloheptyl 3-(aziridin-1-yl)propanoate may exhibit interesting biological activities due to the presence of the aziridine ring, which is often associated with various pharmacological properties. Its specific applications and behavior in chemical reactions would depend on the conditions and the presence of other reactants. Overall, this compound represents a fascinating example of how structural features can influence chemical behavior and potential applications in medicinal chemistry or materials science.
Formula:C12H21NO2
InChI:InChI=1/C12H21NO2/c14-12(7-8-13-9-10-13)15-11-5-3-1-2-4-6-11/h11H,1-10H2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
