CymitQuimica logo

CAS 99902-10-0

:

(3R,4S)-3,4-di(propan-2-yl)hexane-2,5-dione

Description:
The chemical substance known as (3R,4S)-3,4-di(propan-2-yl)hexane-2,5-dione, with the CAS number 99902-10-0, is a chiral diketone characterized by its specific stereochemistry at the 3 and 4 positions of the hexane backbone. This compound features two isopropyl groups attached to the 3 and 4 carbon atoms, contributing to its bulk and steric hindrance. The diketone functional groups at positions 2 and 5 provide reactivity typical of carbonyl compounds, allowing for various chemical transformations such as condensation reactions or nucleophilic additions. The presence of the chiral centers indicates that this compound can exist in two enantiomeric forms, which may exhibit different biological activities or properties. Its physical properties, such as boiling point, melting point, and solubility, would depend on the specific molecular interactions and the presence of functional groups. Overall, this compound is of interest in organic synthesis and may have applications in pharmaceuticals or materials science due to its unique structural features.
Formula:C12H22O2
InChI:InChI=1/C12H22O2/c1-7(2)11(9(5)13)12(8(3)4)10(6)14/h7-8,11-12H,1-6H3/t11-,12+
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.