CAS 99902-71-3
:6-(4-Acetylphenoxy)-3-pyridinecarbonitrile
Description:
6-(4-Acetylphenoxy)-3-pyridinecarbonitrile, with the CAS number 99902-71-3, is an organic compound characterized by its unique structural features, which include a pyridine ring, a carbonitrile group, and an acetylphenoxy moiety. This compound typically exhibits a moderate to high level of lipophilicity due to the presence of aromatic rings, which can influence its solubility in organic solvents. The carbonitrile functional group contributes to its potential reactivity, particularly in nucleophilic addition reactions. Additionally, the acetyl group can enhance the compound's stability and influence its electronic properties. The presence of the pyridine ring may impart basicity and can participate in coordination with metal ions, making it of interest in coordination chemistry. Overall, this compound may have applications in pharmaceuticals or agrochemicals, where its specific interactions and properties can be leveraged for desired biological or chemical activities. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C14H10N2O2
InChI:InChI=1S/C14H10N2O2/c1-10(17)12-3-5-13(6-4-12)18-14-7-2-11(8-15)9-16-14/h2-7,9H,1H3
InChI key:InChIKey=FZBSLZXPXHUBEM-UHFFFAOYSA-N
SMILES:O(C1=CC=C(C(C)=O)C=C1)C2=CC=C(C#N)C=N2
Synonyms:- 3-Pyridinecarbonitrile, 6-(4-acetylphenoxy)-
- 6-(4-Acetylphenoxy)-3-pyridinecarbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
