
CAS 99902-73-5
:6-(3,4-Dichlorophenoxy)-3-pyridinecarbonitrile
Description:
6-(3,4-Dichlorophenoxy)-3-pyridinecarbonitrile, identified by its CAS number 99902-73-5, is a chemical compound that features a pyridine ring substituted with a cyano group and a phenoxy group containing dichlorine substituents. This compound typically exhibits characteristics common to pyridine derivatives, including potential applications in agrochemicals, particularly as a herbicide or pesticide. The presence of the cyano group contributes to its reactivity and may influence its biological activity. The dichlorophenoxy moiety enhances its lipophilicity, which can affect its absorption and distribution in biological systems. Additionally, the compound may display specific solubility properties in organic solvents, making it suitable for various formulations. Its structural features suggest that it may interact with biological targets, potentially leading to herbicidal activity. As with many chemical substances, safety data, including toxicity and environmental impact, should be considered when handling or utilizing this compound in research or industrial applications.
Formula:C12H6Cl2N2O
InChI:InChI=1S/C12H6Cl2N2O/c13-10-3-2-9(5-11(10)14)17-12-4-1-8(6-15)7-16-12/h1-5,7H
InChI key:InChIKey=AOANSHKOZLKQQA-UHFFFAOYSA-N
SMILES:O(C1=CC(Cl)=C(Cl)C=C1)C2=CC=C(C#N)C=N2
Synonyms:- 3-Pyridinecarbonitrile, 6-(3,4-dichlorophenoxy)-
- 6-(3,4-Dichlorophenoxy)-3-pyridinecarbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
